| Name |
(-)-Maackiain Maackiain Inermin Demethylpterocarpin 3-Hydroxy-8,9-methylenedioxypterocarpan |
| Formula |
C16H12O5 |
| Mw |
284.06847349 |
| CAS RN |
2035-15-6 |
| C_ID |
C00002546
, 
|
| InChIKey |
HUKSJTUUSUGIDC-XOAMCLMSNA-N |
| InChICode |
InChI=1S/C16H12O5/c17-8-1-2-9-12(3-8)18-6-11-10-4-14-15(20-7-19-14)5-13(10)21-16(9)11/h1-5,11,16-17H,6-7H2/t11-,16-/m0/s1 |
| SMILES |
Oc1ccc2c(c1)OC[C@H]1c3cc4c(cc3O[C@@H]21)OCO4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia indica  | Ref. |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Fabaceae | Andira inermis  | Ref. |
| Plantae | Fabaceae | Astragalus trojanus  | Ref. |
| Plantae | Fabaceae | Butea monosperma  | Ref. |
| Plantae | Fabaceae | Camptosema rubicundum | Ref. |
| Plantae | Fabaceae | Canavalia bonariensis | Ref. |
| Plantae | Fabaceae | Canavalia galeata | Ref. |
| Plantae | Fabaceae | Canavalia gladiata  | Ref. |
| Plantae | Fabaceae | Canavalia rosea  | Ref. |
| Plantae | Fabaceae | Canavalia sericea | Ref. |
| Plantae | Fabaceae | Caragana acanthophylla | Ref. |
| Plantae | Fabaceae | Caragana altaica | Ref. |
| Plantae | Fabaceae | Caragana ambigua  | Ref. |
| Plantae | Fabaceae | Caragana arborescens  | Ref. |
| Plantae | Fabaceae | Caragana aurantiaca | Ref. |
| Plantae | Fabaceae | Caragana boisii | Ref. |
| Plantae | Fabaceae | Caragana brevispina  | Ref. |
| Plantae | Fabaceae | Caragana conferta | Ref. |
| Plantae | Fabaceae | Caragana decorticans | Ref. |
| Plantae | Fabaceae | Caragana densa | Ref. |
| Plantae | Fabaceae | Caragana erinacea | Ref. |
| Plantae | Fabaceae | Caragana franchetiana | Ref. |
| Plantae | Fabaceae | Caragana frutex | Ref. |
| Plantae | Fabaceae | Caragana fruticosa | Ref. |
| Plantae | Fabaceae | Caragana gerardiana | Ref. |
| Plantae | Fabaceae | Caragana grandiflora | Ref. |
| Plantae | Fabaceae | Caragana jubata | Ref. |
| Plantae | Fabaceae | Caragana kirghisorum | Ref. |
| Plantae | Fabaceae | Caragana laeta | Ref. |
| Plantae | Fabaceae | Caragana microphylla  | Ref. |
| Plantae | Fabaceae | Caragana pekinensis | Ref. |
| Plantae | Fabaceae | Caragana pleiophylla | Ref. |
| Plantae | Fabaceae | Caragana pumila | Ref. |
| Plantae | Fabaceae | Caragana pygmaea | Ref. |
| Plantae | Fabaceae | Caragana sinica  | Ref. |
| Plantae | Fabaceae | Caragana sophorifolia | Ref. |
| Plantae | Fabaceae | Caragana spinosa | Ref. |
| Plantae | Fabaceae | Caragana stenophylla  | Ref. |
| Plantae | Fabaceae | Caragana tangutica | Ref. |
| Plantae | Fabaceae | Caragana tibetica | Ref. |
| Plantae | Fabaceae | Caragana tragacanthoides | Ref. |
| Plantae | Fabaceae | Caragana turkestanica | Ref. |
| Plantae | Fabaceae | Caragana ussuriensis | Ref. |
| Plantae | Fabaceae | Cicer anatolicum | Ref. |
| Plantae | Fabaceae | Cicer arietinum  | Ref. |
| Plantae | Fabaceae | Cicer bijugum | Ref. |
| Plantae | Fabaceae | Cicer canariensis | Ref. |
| Plantae | Fabaceae | Cicer chorassanicum | Ref. |
| Plantae | Fabaceae | Cicer cuneatum | Ref. |
| Plantae | Fabaceae | Cicer echinospermum | Ref. |
| Plantae | Fabaceae | Cicer judicum | Ref. |
| Plantae | Fabaceae | Cicer macracanthum | Ref. |
| Plantae | Fabaceae | Cicer microphyllum | Ref. |
| Plantae | Fabaceae | Cicer mogolatvicum | Ref. |
| Plantae | Fabaceae | Cicer montbretii | Ref. |
| Plantae | Fabaceae | Cicer nuristanicum | Ref. |
| Plantae | Fabaceae | Cicer oxyodon | Ref. |
| Plantae | Fabaceae | Cicer pinnatifidum | Ref. |
| Plantae | Fabaceae | Cicer pungens | Ref. |
| Plantae | Fabaceae | Cicer rechingeri | Ref. |
| Plantae | Fabaceae | Cicer reticulatum | Ref. |
| Plantae | Fabaceae | Cicer songaricum | Ref. |
| Plantae | Fabaceae | Cicer yamashitae | Ref. |
| Plantae | Fabaceae | Dalbergia sericea | Ref. |
| Plantae | Fabaceae | Derris indica  | Ref. |
| Plantae | Fabaceae | Derris scandens Benth.  | Ref. |
| Plantae | Fabaceae | Echinosophora koreensis | Ref. |
| Plantae | Fabaceae | Euchresta formosana | Ref. |
| Plantae | Fabaceae | Galactia jussiaeana | Ref. |
| Plantae | Fabaceae | Galactia striata | Ref. |
| Plantae | Fabaceae | Glycyrrhiza pallidiflora | Ref. |
| Plantae | Fabaceae | Lathyrus aphaca  | Ref. |
| Plantae | Fabaceae | Lathyrus cicera  | Ref. |
| Plantae | Fabaceae | Lathyrus grandiflorus | Ref. |
| Plantae | Fabaceae | Lathyrus hirsutus | Ref. |
| Plantae | Fabaceae | Lathyrus linifolius | Ref. |
| Plantae | Fabaceae | Lathyrus ochrus  | Ref. |
| Plantae | Fabaceae | Lathyrus palustris | Ref. |
| Plantae | Fabaceae | Lathyrus roseus | Ref. |
| Plantae | Fabaceae | Lathyrus sylvestris | Ref. |
| Plantae | Fabaceae | Lathyrus tuberosus  | Ref. |
| Plantae | Fabaceae | Maackia amurensis  | Ref. |
| Plantae | Fabaceae | Millettia pachyloba | Ref. |
| Plantae | Fabaceae | Millettia sp. | Ref. |
| Plantae | Fabaceae | Mucuna poggei | Ref. |
| Plantae | Fabaceae | Mucuna pruriens  | Ref. |
| Plantae | Fabaceae | Ononis alopecuroides | Ref. |
| Plantae | Fabaceae | Ononis biflora | Ref. |
| Plantae | Fabaceae | Ononis hispida | Ref. |
| Plantae | Fabaceae | Ononis minutissima | Ref. |
| Plantae | Fabaceae | Ononis mitissima | Ref. |
| Plantae | Fabaceae | Ononis natrix  | Ref. |
| Plantae | Fabaceae | Ononis oligophylla | Ref. |
| Plantae | Fabaceae | Ononis pinnata | Ref. |
| Plantae | Fabaceae | Ononis speciosa | Ref. |
| Plantae | Fabaceae | Ononis spinosa  | Ref. |
| Plantae | Fabaceae | Ononis subspicata | Ref. |
| Plantae | Fabaceae | Ononis variegata | Ref. |
| Plantae | Fabaceae | Ononis viscosa subsp. breviflora  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Psorothamnus arborescens | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Sophora franchetiana | Ref. |
| Plantae | Fabaceae | Sophora gypsophila | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Sophora subprostrata | Ref. |
| Plantae | Fabaceae | Sophora substrata | Ref. |
| Plantae | Fabaceae | Sophora tetraptera  | Ref. |
| Plantae | Fabaceae | Sophora tomentosa  | Ref. |
| Plantae | Fabaceae | Swartzia madagascariensis  | Ref. |
| Plantae | Fabaceae | Tephrosia purpurea  | Ref. |
| Plantae | Fabaceae | Tephrosia villosa  | Ref. |
| Plantae | Fabaceae | Tephrosia virginiana | Ref. |
| Plantae | Fabaceae | Trifolium africanum | Ref. |
| Plantae | Fabaceae | Trifolium alpestre | Ref. |
| Plantae | Fabaceae | Trifolium angulatum | Ref. |
| Plantae | Fabaceae | Trifolium bullatum | Ref. |
| Plantae | Fabaceae | Trifolium clusii | Ref. |
| Plantae | Fabaceae | Trifolium congestum | Ref. |
| Plantae | Fabaceae | Trifolium dalmaticum | Ref. |
| Plantae | Fabaceae | Trifolium diffusum | Ref. |
| Plantae | Fabaceae | Trifolium heldreichianum | Ref. |
| Plantae | Fabaceae | Trifolium ligusticum | Ref. |
| Plantae | Fabaceae | Trifolium medium | Ref. |
| Plantae | Fabaceae | Trifolium miegeanum | Ref. |
| Plantae | Fabaceae | Trifolium montanum | Ref. |
| Plantae | Fabaceae | Trifolium ornithopodioides | Ref. |
| Plantae | Fabaceae | Trifolium pallidum | Ref. |
| Plantae | Fabaceae | Trifolium patulum | Ref. |
| Plantae | Fabaceae | Trifolium pauciflorum | Ref. |
| Plantae | Fabaceae | Trifolium phleoides | Ref. |
| Plantae | Fabaceae | Trifolium pignantii | Ref. |
| Plantae | Fabaceae | Trifolium pratense L.  | Ref. |
| Plantae | Fabaceae | Trifolium purpureum | Ref. |
| Plantae | Fabaceae | Trifolium saxatile | Ref. |
| Plantae | Fabaceae | Trifolium spp. | Ref. |
| Plantae | Fabaceae | Trifolium tenuifolium | Ref. |
| Plantae | Fabaceae | Trifolium trichocephalum | Ref. |
| Plantae | Fabaceae | Trifolium vavilovii | Ref. |
| Plantae | Fabaceae | Trigonella spp. | Ref. |
| Plantae | Fabaceae | Ulex jussiaei | Ref. |
| Plantae | Fabaceae | Ulex minor | Ref. |
| Plantae | Fabaceae | Ulex parviflorus | Ref. |
| Plantae | Pinaceae | Pinus sativa | Ref. |
| - | - | Onionis viscosa ssp. breviflora | Ref. |
|
|
zoom in
| Organism | Andira inermis | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Xing, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 28, (2003), 593.
Mahabusarakama, et al., Phytochemistry, 65, (2004), 1185.
Matsuda, et al., Planta Med, 70, (2004), 1201.
Karikome, Wen-ben Yang translated, Phytochemistry, Science Press, Beijing, (1985).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|