| Name |
Supinidine |
| Formula |
C8H13NO |
| Mw |
139.09971404 |
| CAS RN |
551-59-7 |
| C_ID |
C00002120
, 
|
| InChIKey |
XMJAZPFSQQKHEG-SVGMAFHSNA-N |
| InChICode |
InChI=1S/C8H13NO/c10-6-7-3-5-9-4-1-2-8(7)9/h3,8,10H,1-2,4-6H2/t8-/m0/s1 |
| SMILES |
OCC1=CCN2CCC[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Ala |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Heliotropium angiospermum  | Ref. |
| Plantae | Boraginaceae | Heliotropium curassavicum | Ref. |
| Plantae | Boraginaceae | Heliotropium indicum  | Ref. |
| Plantae | Boraginaceae | Heliotropium spathulatum | Ref. |
| Plantae | Boraginaceae | Heliotropium spp. | Ref. |
|
|
zoom in
| Organism | Heliotropium indicum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|