| Name |
Rinderine |
| Formula |
C15H25NO5 |
| Mw |
299.17327292 |
| CAS RN |
6029-84-1 |
| C_ID |
C00002111
, 
|
| InChIKey |
SFVVQRJOGUKCEG-GBXZDLQFNA-N |
| InChICode |
InChI=1S/C15H25NO5/c1-9(2)15(20,10(3)17)14(19)21-8-11-4-6-16-7-5-12(18)13(11)16/h4,9-10,12-13,17-18,20H,5-8H2,1-3H3/t10-,12+,13-,15+/m1/s1 |
| SMILES |
CC(C)[C@@](O)(C(=O)OCC1=CCN2CC[C@H](O)[C@@H]12)[C@@H](C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Ala L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Eupatorium altissimum | Ref. |
| Plantae | Asteraceae | Eupatorium cannabinum  | Ref. |
| Plantae | Asteraceae | Eupatorium cannabium | Ref. |
| Plantae | Boraginaceae | Heliotropium indicum  | Ref. |
| Plantae | Boraginaceae | Heliotropium transalpinum | Ref. |
| Plantae | Boraginaceae | Rindera baldschuanica | Ref. |
| Plantae | Boraginaceae | Solenanthus circinatus | Ref. |
|
|
zoom in
| Organism | Eupatorium cannabium | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|