| Name |
Isolycopsamine |
| Formula |
C15H25NO5 |
| Mw |
299.17327292 |
| CAS RN |
6224-43-7 |
| C_ID |
C00002095
, 
|
| InChIKey |
OMMHYUSJYAJBDU-DSJHFPPSNA-N |
| InChICode |
InChI=1S/C15H25NO5/c1-9(2)15(20,10(3)18)14(19)21-12-5-7-16-6-4-11(8-17)13(12)16/h4,9-10,12-13,17-18,20H,5-8H2,1-3H3/t10-,12-,13-,15-/m1/s1 |
| SMILES |
CC(C)[C@](O)(C(=O)O[C@@H]1CCN2CC=C(CO)[C@H]12)[C@@H](C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Amsinckia douglasiana | Ref. |
| Plantae | Boraginaceae | Cryptantha confertiflora | Ref. |
| Plantae | Boraginaceae | Heliotropium keralense | Ref. |
| Plantae | Boraginaceae | Heliotropium spathulatum | Ref. |
|
|
zoom in
| Organism | Heliotropium keralense | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|