| Name |
Europine |
| Formula |
C16H27NO6 |
| Mw |
329.1838376 |
| CAS RN |
570-19-4 |
| C_ID |
C00002086
, 
|
| InChIKey |
ZNEMYFCJOCCUJN-XKXFZMAENA-N |
| InChICode |
InChI=1S/C16H27NO6/c1-10(22-4)16(21,15(2,3)20)14(19)23-9-11-5-7-17-8-6-12(18)13(11)17/h5,10,12-13,18,20-21H,6-9H2,1-4H3/t10-,12-,13+,16-/m0/s1 |
| SMILES |
CO[C@@H](C)[C@](O)(C(=O)OCC1=CCN2CC[C@H](O)[C@@H]12)C(C)(C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg L-His Cholesterol |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Arnebia decumbens | Ref. |
| Plantae | Boraginaceae | Heliotropium arbainense | Ref. |
| Plantae | Boraginaceae | Heliotropium bacciferum  | Ref. |
| Plantae | Boraginaceae | Heliotropium bovei | Ref. |
| Plantae | Boraginaceae | Heliotropium circinatum | Ref. |
| Plantae | Boraginaceae | Heliotropium crassifoium | Ref. |
| Plantae | Boraginaceae | Heliotropium dissitiflorum | Ref. |
| Plantae | Boraginaceae | Heliotropium esfandiarii | Ref. |
| Plantae | Boraginaceae | Heliotropium europaeum  | Ref. |
| Plantae | Boraginaceae | Heliotropium hirsutissimum | Ref. |
| Plantae | Boraginaceae | Heliotropium maris-mortui | Ref. |
| Plantae | Boraginaceae | Heliotropium rotundifolium | Ref. |
| Plantae | Boraginaceae | Trichodesma africana | Ref. |
| - | - | Heliotorpium digynum | Ref. |
|
|
zoom in
| Organism | Heliotropium bacciferum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|