| Name |
Hygrine (+)-Hygrine D-(+)-Hygrine |
| Formula |
C8H15NO |
| Mw |
141.11536411 |
| CAS RN |
496-49-1 |
| C_ID |
C00002046
, 
|
| InChIKey |
ADKXZIOQKHHDNQ-SVGMAFHSNA-N |
| InChICode |
InChI=1S/C8H15NO/c1-7(10)6-8-4-3-5-9(8)2/h8H,3-6H2,1-2H3/t8-/m0/s1 |
| SMILES |
CC(=O)C[C@@H]1CCCN1C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Convolvulaceae | Argyreia mollis | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum coca  | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum novogranatense | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Orchidaceae | Dendrobium chrysanthum | Ref. |
| Plantae | Solanaceae | Atropa baetica | Ref. |
| Plantae | Solanaceae | Hyoscyamus albus  | Ref. |
| Plantae | Solanaceae | Hyoscyamus boveanus | Ref. |
| Plantae | Solanaceae | Hyoscyamus desertorum | Ref. |
| Plantae | Solanaceae | Hyoscyamus muticus  | Ref. |
| Plantae | Solanaceae | Nicandra physaloides | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Physalis alkekengi L.  | Ref. |
| Plantae | Solanaceae | Physalis peruviana  | Ref. |
| - | - | Corallia brachiata | Ref. |
| - | - | Erythroxylon coca  | Ref. |
|
|
zoom in
| Organism | Erythroxylum novogranatense | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|