| Name |
Tiliacorine |
| Formula |
C36H36N2O5 |
| Mw |
576.26242227 |
| CAS RN |
27073-72-9 |
| C_ID |
C00001925
, 
|
| InChIKey |
DQIJJKSVYLLDQW-LEFKRGDZNA-N |
| InChICode |
InChI=1S/C36H36N2O5/c1-37-11-9-22-17-31-32-19-24(22)27(37)15-20-5-7-29(39)25(13-20)26-14-21(6-8-30(26)40-3)16-28-34-23(10-12-38(28)2)18-33(41-4)35(42-31)36(34)43-32/h5-8,13-14,17-19,27-28,39H,9-12,15-16H2,1-4H3/t27-,28-/m0/s1 |
| SMILES |
COc1ccc2cc1-c1cc(ccc1O)C[C@H]1c3cc4c(cc3CCN1C)Oc1c(OC)cc3c(c1O4)[C@H](C2)N(C)CC3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr L-Phe |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Menispermaceae | Tiliacora acuminata  | Ref. |
| Plantae | Menispermaceae | Tiliacora racemosa | Ref. |
| - | - | family Menispermaceae spp. | Ref. |
|
|
zoom in
| Organism | family Menispermaceae spp. | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|