| Name |
Amurensine |
| Formula |
C19H19NO4 |
| Mw |
325.1314081 |
| CAS RN |
10481-92-2 |
| C_ID |
C00001801
, 
|
| InChIKey |
HDQHRTXBXYQUNW-PVRQQBJHNA-N |
| InChICode |
InChI=1S/C19H19NO4/c1-20-8-14-11-6-19-18(23-9-24-19)4-10(11)3-15(20)13-7-17(22-2)16(21)5-12(13)14/h4-7,14-15,21H,3,8-9H2,1-2H3/t14-,15+/m1/s1 |
| SMILES |
COc1cc2c(cc1O)[C@H]1CN(C)[C@@H]2Cc2cc3c(cc21)OCO3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Papaveraceae | Papaver alpinum | Ref. |
| Plantae | Papaveraceae | Papaver caucasicum | Ref. |
| Plantae | Papaveraceae | Papaver kerneri | Ref. |
| Plantae | Papaveraceae | Papaver nudicaule var. amurense | Ref. |
|
|
zoom in
| Organism | Papaver kerneri | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|