| Name |
Mesembrenone |
| Formula |
C17H21NO3 |
| Mw |
287.15214354 |
| CAS RN |
80287-15-6 |
| C_ID |
C00001748
, 
|
| InChIKey |
HDNHBCSWFYFPAN-RXQGYGPJNA-N |
| InChICode |
InChI=1S/C17H21NO3/c1-18-9-8-17(7-6-13(19)11-16(17)18)12-4-5-14(20-2)15(10-12)21-3/h4-7,10,16H,8-9,11H2,1-3H3/t16-,17-/m0/s1 |
| SMILES |
COc1ccc([C@@]23C=CC(=O)C[C@@H]2N(C)CC3)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aizoaceae | Mesembryanthemum anatomicum  | Ref. |
| Plantae | Aizoaceae | Mesembryanthemum expansum | Ref. |
| Plantae | Aizoaceae | Mesembryanthemum tortuosum  | Ref. |
| Plantae | Aizoaceae | Sceletium anatomicum | Ref. |
| Plantae | Aizoaceae | Sceletium expansum | Ref. |
| Plantae | Aizoaceae | Sceletium tortuosum  | Ref. |
|
|
zoom in
| Organism | Mesembryanthemum tortuosum | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|