| Name |
Leurosine |
| Formula |
C46H56N4O9 |
| Mw |
808.40472942 |
| CAS RN |
23360-92-1 |
| C_ID |
C00001744
, 
|
| InChIKey |
LPGWZGMPDKDHEP-RGLLKGLVNA-N |
| InChICode |
InChI=1S/C46H56N4O9/c1-8-42-16-12-18-50-20-17-44(37(42)50)30-21-31(34(55-5)22-33(30)48(4)38(44)46(54,41(53)57-7)39(42)58-26(3)51)45(40(52)56-6)23-27-24-49(25-43(9-2)36(27)59-43)19-15-29-28-13-10-11-14-32(28)47-35(29)45/h10-14,16,21-22,27,36-39,47,54H,8-9,15,17-20,23-25H2,1-7H3/t27-,36-,37-,38-,39-,42-,43+,44-,45+,46+/m1/s1 |
| SMILES |
CC[C@]12C[N@@]3CCc4c([nH]c5ccccc45)[C@@](C(=O)OC)(c4cc5c(cc4OC)N(C)[C@H]4[C@@](O)(C(=O)OC)[C@H](OC(C)=O)[C@]6(CC)C=CCN7CC[C@]54[C@@H]76)C[C@H](C3)[C@H]1O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Catharanthus lanceus | Ref. |
| Plantae | Apocynaceae | Catharanthus longifolius | Ref. |
| Plantae | Apocynaceae | Catharanthus ovalis | Ref. |
| Plantae | Apocynaceae | Catharanthus pusillus | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Apocynaceae | Catharanthus spp. | Ref. |
| Plantae | Apocynaceae | Vinca rosea  | Ref. |
|
|
zoom in
| Organism | Catharanthus ovalis | | Reference | Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|