| Name |
Lycaconitine |
| Formula |
C36H48N2O10 |
| Mw |
668.33089577 |
| CAS RN |
25867-19-0 |
| C_ID |
C00001652
, 
|
| InChIKey |
KFXVNXQXPRPLQA-VOUSOKOLNA-N |
| InChICode |
InChI=1S/C36H48N2O10/c1-6-37-17-33(18-48-31(41)19-9-7-8-10-22(19)38-25(39)11-12-26(38)40)14-13-24(45-3)35-21-15-20-23(44-2)16-34(42,27(21)28(20)46-4)36(43,32(35)37)30(47-5)29(33)35/h7-10,20-21,23-24,27-30,32,42-43H,6,11-18H2,1-5H3/t20-,21-,23+,24+,27-,28+,29-,30+,32+,33+,34-,35+,36-/m1/s1 |
| SMILES |
CCN1C[C@@]2(COC(=O)c3ccccc3N3C(=O)CCC3=O)CC[C@H](OC)[C@]34C1[C@](O)([C@@H](OC)[C@H]23)[C@@]1(O)C[C@H](OC)[C@H]2C[C@@H]4[C@@H]1[C@H]2OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ranunculaceae | Aconitum barbatum var.puberulum | Ref. |
| Plantae | Ranunculaceae | Aconitum lycoctonum  | Ref. |
| Plantae | Ranunculaceae | Delphinium cashmerianum  | Ref. |
| Plantae | Ranunculaceae | Delphinium cashmirianum  | Ref. |
|
|
zoom in
| Organism | Delphinium cashmerianum | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|