| Name |
Kinetin |
| Formula |
C10H9N5O |
| Mw |
215.08070995 |
| CAS RN |
525-79-1 |
| C_ID |
C00001504
, 
|
| InChIKey |
QANMHLXAZMSUEX-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H9N5O/c1-2-7(16-3-1)4-11-9-8-10(13-5-12-8)15-6-14-9/h1-3,5-6H,4H2,(H2,11,12,13,14,15) |
| SMILES |
c1coc(CNc2ncnc3[nH]cnc23)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
Anthranilate L-Asp L-Phe L-His |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Caryophyllales | Beta vulgaris | Ref. |
| Plantae | Cruciferae | Isatis indigotica | Ref. |
| Plantae | Palmae | Cocos nucifera | Ref. |
| Plantae | Poaceae | Oryza sativa | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum | Ref. |
| - | - | | Ref. |
|
|
zoom in
| Organism | Isatis indigotica |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
