| Name |
Naphthalene |
| Formula |
C10H8 |
| Mw |
128.06260026 |
| CAS RN |
91-20-3 |
| C_ID |
C00001259
, 
|
| InChIKey |
UFWIBTONFRDIAS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H |
| SMILES |
c1ccc2ccccc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Exhaled breath) | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Saposhnikovia divaricata | Ref. |
| Plantae | Aristolochiaceae | Asarum sieboldii  | Ref. |
| Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Herbertaceae | Herbertus sakuraii | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Magnoliaceae | Magnolia denudata  | Ref. |
| Plantae | Magnoliaceae | Magnolia liliiflora  | Ref. |
| Plantae | Magnoliaceae | Magnolia praecocissima  | Ref. |
| Plantae | Magnoliaceae | Magnolia tomentosa | Ref. |
| Plantae | Rosaceae | Prunus armeniaca L. (K604-19,K113-40,K33-81)  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus salcina Lindl. (Blackamber,Friar) | Ref. |
| Plantae | Rutaceae | Ruta graveolens  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| - | - | Microcystis aeruginosa | Ref. |
|
|
zoom in
| Organism | Saposhnikovia divaricata | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|