| Name |
Sequoyitol 5-O-Methyl-myo-inositol |
| Formula |
C7H14O6 |
| Mw |
194.07903818 |
| CAS RN |
523-92-2 |
| C_ID |
C00001172
, 
|
| InChIKey |
DSCFFEYYQKSRSV-XIQRMMNUNA-N |
| InChICode |
InChI=1S/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3/t2-,3-,4-,5+,6-,7+/m0/s1 |
| SMILES |
COC1C(O)[C@H](O)C(O)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aristolochiaceae | Aristolochia debilis  | Ref. |
| Plantae | Cephalotaxaceae | Amentotaxus yunnanensis | Ref. |
| Plantae | Cephalotaxaceae | Cephalotaxus fortunei | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Rutaceae | Melicope micrococca | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Taxodiaceae | Sequoia sempervirens | Ref. |
|
|
zoom in
| Organism | Cephalotaxus fortunei | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Li, et al., JNP, 66, (2003), 1002 |
|---|
|