| Name |
Sedoheptulose beta-D-altro-2-Heptulopyranose |
| Formula |
C7H14O7 |
| Mw |
210.0739528 |
| CAS RN |
470-46-2 |
| C_ID |
C00001132
, 
|
| InChIKey |
HAIWUXASLYEWLM-AZPSEJNANA-N |
| InChICode |
InChI=1S/C7H14O7/c8-1-3-4(10)5(11)6(12)7(13,2-9)14-3/h3-6,8-13H,1-2H2/t3-,4-,5-,6-,7+/m0/s1 |
| SMILES |
OCC1O[C@](O)(CO)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Crassulaceae | Sedum aizoon  | Ref. |
| Plantae | Crassulaceae | Sedum sarmentosum  | Ref. |
| Plantae | Crassulaceae | Sedum spectabile | Ref. |
| Plantae | Illiciaceae | Illicium anisatum  | Ref. |
| Plantae | Oxalidaceae | Averrhoa carambola  | Ref. |
| Plantae | Papaveraceae | Papaver somniferum  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
|
|
zoom in
| Organism | Sedum sarmentosum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|