| Name |
Robustaflavone |
| Formula |
C30H18O10 |
| Mw |
538.0899968 |
| CAS RN |
49620-13-5 |
| C_ID |
C00001094
, 
|
| InChIKey |
BORWSEZUWHQTOK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C30H18O10/c31-15-4-1-13(2-5-15)23-11-22(37)29-26(39-23)12-20(35)27(30(29)38)17-7-14(3-6-18(17)33)24-10-21(36)28-19(34)8-16(32)9-25(28)40-24/h1-12,31-35,38H |
| SMILES |
O=c1cc(-c2ccc(O)c(-c3c(O)cc4oc(-c5ccc(O)cc5)cc(=O)c4c3O)c2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Rhus spp. | Ref. |
| Plantae | Anacardiaceae | Rhus succedanea  | Ref. |
| Plantae | Araucariaceae | Agathis robusta | Ref. |
| Plantae | Araucariaceae | Araucaria spp. | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia brevipedicellata | Ref. |
| Plantae | Cupressaceae | Juniperus spp. | Ref. |
| Plantae | Podocarpaceae | Podocarpus imbricatus | Ref. |
| Plantae | Taxodiaceae | Cunninghamia lanceolata Hook.f.  | Ref. |
| - | - | Selaginella delicatula | Ref. |
|
|
zoom in
| Organism | Agathis robusta | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Varshney,Experientia,29,(1973),784
Lin,Phytochem.,13,(1974),1617 |
|---|
|