| Name |
Kuwanone G Albanin F |
| Formula |
C40H36O11 |
| Mw |
692.22576199 |
| CAS RN |
75629-19-5 |
| C_ID |
C00001063
, 
|
| InChIKey |
APPXYONGBIXGRO-PFWABSNWNA-N |
| InChICode |
InChI=1S/C40H36O11/c1-18(2)4-8-26-38(50)36-33(48)17-32(47)35(40(36)51-39(26)25-11-7-22(43)16-31(25)46)28-13-19(3)12-27(23-9-5-20(41)14-29(23)44)34(28)37(49)24-10-6-21(42)15-30(24)45/h4-7,9-11,13-17,27-28,34,41-48H,8,12H2,1-3H3/t27-,28+,34-/m0/s1 |
| SMILES |
CC(C)=CCc1c(-c2ccc(O)cc2O)oc2c([C@H]3C=C(C)C[C@@H](c4ccc(O)cc4O)[C@@H]3C(=O)c3ccc(O)cc3O)c(O)cc(O)c2c1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moraceae | Morus australis  | Ref. |
| Plantae | Moraceae | Morus mongolica  | Ref. |
|
|
zoom in
| Organism | Morus mongolica | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Nomura,Tetrahedron Lett.,22,(1981),2195
Hano,Heterocycles,27,(1988),2315 |
|---|
|