| Name |
Kaempferide |
| Formula |
C16H12O6 |
| Mw |
300.06338812 |
| CAS RN |
491-54-3 |
| C_ID |
C00001060
, 
|
| InChIKey |
SQFSKOYWJBQGKQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O6/c1-21-10-4-2-8(3-5-10)16-15(20)14(19)13-11(18)6-9(17)7-12(13)22-16/h2-7,17-18,20H,1H3 |
| SMILES |
COc1ccc(-c2oc3cc(O)cc(O)c3c(=O)c2O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Semecarpus vitiensis | Ref. |
| Plantae | Asteraceae | Baccharis pilularis | Ref. |
| Plantae | Asteraceae | Baccharis viminea | Ref. |
| Plantae | Asteraceae | Chrysothamnus nauseosus | Ref. |
| Plantae | Asteraceae | Ozothamnus scutellifolius | Ref. |
| Plantae | Calceolariaceae | Calceolaria irazeunsis | Ref. |
| Plantae | Caryophyllaceae | Dianthus caryophyllus  | Ref. |
| Plantae | Costaceae | Costus spicatus  | Ref. |
| Plantae | Crassulaceae | Sedum sarmentosum  | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Cunoniaceae | Eucryphia jinksii | Ref. |
| Plantae | Fabaceae | Astragalus complanatus  | Ref. |
| Plantae | Fabaceae | Genista aetnensis | Ref. |
| Plantae | Hydrophyllaceae | Eriodictyon sessilifolium | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus menziesii | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus nervosa | Ref. |
| Plantae | Nyctaginaceae | Mirabilis viscosa | Ref. |
| Plantae | Plantaginaceae | Linaria dalmatica | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Tamaricaceae | Tamarix chinensis | Ref. |
| Plantae | Zingiberaceae | Alpinia officinarum  | Ref. |
| Plantae | Zingiberaceae | Kaempferia galanga  | Ref. |
| - | - | Currania robertiana | Ref. |
|
|
zoom in
| Organism | Baccharis viminea | | Reference | Wollenweber,Proceeding of the International Compositae Conference,(1994)
Hind,Royal Botanic Gardens,(1996) |
|---|
|