| Name |
(+)-Epicatechin ent-Epicatechin |
| Formula |
C15H14O6 |
| Mw |
290.07903818 |
| CAS RN |
35323-91-2 |
| C_ID |
C00000957
, 
|
| InChIKey |
PFTAWBLQPZVEMU-DDOUFSBJNA-N |
| InChICode |
InChI=1S/C15H14O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-5,13,15-20H,6H2/t13-,15-/m0/s1 |
| SMILES |
Oc1cc(O)c2c(c1)O[C@@H](c1ccc(O)c(O)c1)[C@@H](O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Arecaceae | Livistona chinensis | Ref. |
| Plantae | Celastraceae | Gymnosporia trigyna | Ref. |
| Plantae | Fabaceae | Cassia fistula  | Ref. |
| Plantae | Oxalidaceae | Averrhoa carambola L.  | Ref. |
| Plantae | Palmae | Chamaerops humilis  | Ref. |
| Plantae | Polygonaceae | Polygonum multiflorum  | Ref. |
| Plantae | Rosaceae | Dryas octopetala  | Ref. |
| Plantae | Rubiaceae | Pavetta owariensis  | Ref. |
| Plantae | Rubiaceae | Uncaria gambir  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
|
|
zoom in
| Organism | Cassia fistula | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Delle Monache,Phytochem.,11,(1972),2333
Kashiwada,Chem.Pharm.Bull.,38,(1990),888 |
|---|
|