| Name |
Butrin |
| Formula |
C27H32O15 |
| Mw |
596.17412036 |
| CAS RN |
492-13-7 |
| C_ID |
C00000946
, 
|
| InChIKey |
QVCQYYYTMIZOGK-SKHLYUKXNA-N |
| InChICode |
InChI=1S/C27H32O15/c28-8-18-20(32)22(34)24(36)26(41-18)38-11-2-3-12-14(31)7-15(39-16(12)6-11)10-1-4-13(30)17(5-10)40-27-25(37)23(35)21(33)19(9-29)42-27/h1-6,15,18-30,32-37H,7-9H2/t15-,18+,19+,20-,21-,22-,23-,24+,25+,26+,27+/m0/s1 |
| SMILES |
O=C1C[C@@H](c2ccc(O)c(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c2)Oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)ccc21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Butea frondosa  | Ref. |
| Plantae | Fabaceae | Butea monosperma  | Ref. |
| Plantae | Fabaceae | Butea superba  | Ref. |
|
|
zoom in
| Organism | Butea superba | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 386,Flavanones and dihydroflavonols
Lal,J.Indian Chem.Soc.,12,(1935),262
Rao,J.Sci.Ind.Res.India,8B,(1949),178 |
|---|
|