| Name |
Shikonin |
| Formula |
C16H16O5 |
| Mw |
288.09977362 |
| CAS RN |
517-89-5 |
| C_ID |
C00000859
, 
|
| InChIKey |
NEZONWMXZKDMKF-UEQNJFAPNA-N |
| InChICode |
InChI=1S/C16H16O5/c1-8(2)3-4-10(17)9-7-13(20)14-11(18)5-6-12(19)15(14)16(9)21/h3,5-7,10,17-19H,4H2,1-2H3/t10-/m1/s1 |
| SMILES |
CC(C)=CC[C@@H](O)C1=CC(=O)c2c(O)ccc(O)c2C1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Staphylococcaceae | Staphylococcus aureus | Ref. |
| Plantae | Boraginaceae | Alkanna euchroma | Ref. |
| Plantae | Boraginaceae | Arnebia benthamii  | Ref. |
| Plantae | Boraginaceae | Arnebia euchroma  | Ref. |
| Plantae | Boraginaceae | Arnebia guttata  | Ref. |
| Plantae | Boraginaceae | Lithospermum erythrorhizon  | Ref. |
| Plantae | Boraginaceae | Lithospermum officinale  | Ref. |
| Plantae | Boraginaceae | Onosma paniculatum | Ref. |
|
|
zoom in
| Organism | Arnebia benthamii | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|