| Name |
Cannabisin D |
| Formula |
C36H36N2O8 |
| Mw |
624.24716614 |
| CAS RN |
144506-19-4 |
| C_ID |
C00000664
, 
|
| InChIKey |
XYTYRVFKBJENPE-ZAWQLKNBNA-N |
| InChICode |
InChI=1S/C36H36N2O8/c1-45-31-18-23(7-12-29(31)41)33-27-20-30(42)32(46-2)19-24(27)17-28(35(43)37-15-13-21-3-8-25(39)9-4-21)34(33)36(44)38-16-14-22-5-10-26(40)11-6-22/h3-12,17-20,33-34,39-42H,13-16H2,1-2H3,(H,37,43)(H,38,44)/t33-,34-/m0/s1 |
| SMILES |
COc1cc([C@H]2c3cc(O)c(OC)cc3C=C(C(=O)NCCc3ccc(O)cc3)[C@@H]2C(=O)NCCc2ccc(O)cc2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Xylopia aethiopica  | Ref. |
| Plantae | Cannabaceae | Cannabis sativa  | Ref. |
| Plantae | Solanaceae | Hyoscyamus niger  | Ref. |
|
|
zoom in
| Organism | Hyoscyamus niger | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|