| Name |
Isomagnolol |
| Formula |
C18H18O2 |
| Mw |
266.13067982 |
| CAS RN |
87688-90-2 |
| C_ID |
C00000592
, 
|
| InChIKey |
ROPDWYIWHWKVLI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H18O2/c1-3-5-14-7-10-16(11-8-14)20-18-13-15(6-4-2)9-12-17(18)19/h3-4,7-13,19H,1-2,5-6H2 |
| SMILES |
C=CCc1ccc(Oc2cc(CC=C)ccc2O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Illiciaceae | Illicium fargesii | Ref. |
| Plantae | Lauraceae | Sassafras randaiense | Ref. |
| Plantae | Magnoliaceae | Magnolia biloba | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
|
|
zoom in
| Organism | Magnolia biloba | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|