| Name |
Indole-3-acetyl-L-aspartic acid |
| Formula |
C14H14N2O5 |
| Mw |
290.09027157 |
| CAS RN |
2456-73-7 |
| C_ID |
C00000117
, 
|
| InChIKey |
VAFNMNRKDDAKRM-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C14H14N2O5/c17-12(16-11(14(20)21)6-13(18)19)5-8-7-15-10-4-2-1-3-9(8)10/h1-4,7,11,15H,5-6H2,(H,16,17)(H,18,19)(H,20,21)/t11-/m1/s1 |
| SMILES |
O=C(O)CC(NC(=O)Cc1c[nH]c2ccccc12)C(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Glycine max.  | Ref. |
| Plantae | Fabaceae | Lupinus angustifolius  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Magnoliaceae | Magnolia sp. | Ref. |
| Plantae | Papaveraceae | Papaver somniferum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| - | - | Gleditschia triacanthos | Ref. |
|
|
zoom in
| Organism | Glycine max. | | Reference | Aldrich Library of 13C and 1H FT NMR Spectra,3,(1992),156A |
|---|
|