| Name |
alpha-terpineol acetate Terpinyl acetate alpha-Terpinyl acetate |
| Formula |
C12H20O2 |
| Mw |
196.14632988 |
| CAS RN |
80-26-2 |
| C_ID |
C00035043
, 
|
| InChIKey |
IGODOXYLBBXFDW-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C12H20O2/c1-9-5-7-11(8-6-9)12(3,4)14-10(2)13/h5,11H,6-8H2,1-4H3/t11-/m0/s1 |
| SMILES |
CC(=O)OC(C)(C)C1CC=C(C)CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Xylopia parviflora  | Ref. |
| Plantae | Apiaceae | Ligusticum jeholense | Ref. |
| Plantae | Canellaceae | Canella winterana  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Fabaceae | Tipuana tipu | Ref. |
| Plantae | Fabaceae | Trifolium repens L.  | Ref. |
| Plantae | Illiciaceae | Illicium anisatum  | Ref. |
| Plantae | Labiatae | Clinopodium nepeta | Ref. |
| Plantae | Lamiaceae | Calamintha nepeta  | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Lauraceae | Laurus nobilis  | Ref. |
| Plantae | Myrtaceae | Eucalyptus gunnii  | Ref. |
| Plantae | Myrtaceae | Eucalyptus resinifera | Ref. |
| Plantae | Myrtaceae | Melaleuca leucadendra L.  | Ref. |
| Plantae | Myrtaceae | Myrtus communis  | Ref. |
| Plantae | Pinaceae | Pinus mugo subsp. Mugo  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Piperaceae | Piper nigrum  | Ref. |
| Plantae | Plantaginaceae | Veronica spicata | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Saxifragaceae | Saxifraga stolonifera  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Zingiberaceae | Curcuma amada  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Veronica spicata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|