| Name |
Sitostenone Stigmast-4-en-3-one Stigmast-4-ene-3-one beta-Sitostenone |
| Formula |
C29H48O |
| Mw |
412.37051615 |
| CAS RN |
1058-61-3 |
| C_ID |
C00029821
, 
|
| InChIKey |
RUVUHIUYGJBLGI-QEVKAYSANA-N |
| InChICode |
InChI=1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h18-21,24-27H,7-17H2,1-6H3/t20-,21-,24+,25-,26+,27+,28+,29-/m1/s1 |
| SMILES |
CC[C@H](CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Meripilaceae | Antrodia camphorata | Ref. |
| Plantae | Aristolochiaceae | Aristolochia mollissima | Ref. |
| Plantae | Asteraceae | Inula cappa  | Ref. |
| Plantae | Asteraceae | Ligularia dentata Hara | Ref. |
| Plantae | Begoniaceae | Begonia nantoensis | Ref. |
| Plantae | Celastraceae | Euonymus alatus  | Ref. |
| Plantae | Celastraceae | Maytenus guianensis | Ref. |
| Plantae | Celastraceae | Microtropis fokienensis | Ref. |
| Plantae | Celastraceae | Microtropis japonica | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia multiflora  | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Dryopteridaceae | Didymochlaena truncatula | Ref. |
| Plantae | Ebenaceae | Diospyros eriantha | Ref. |
| Plantae | Ebenaceae | Diospyros rhodocalyx | Ref. |
| Plantae | Euphorbiaceae | Croton lechleri Mull.Arg.  | Ref. |
| Plantae | Juglandaceae | Engelhardia roxburghiana | Ref. |
| Plantae | Labiatae | Callicarpa pilosissima | Ref. |
| Plantae | Labiatae | Salvia amplexicaulis Lam. | Ref. |
| Plantae | Labiatae | Salvia bucharica | Ref. |
| Plantae | Labiatae | Salvia multicaulis  | Ref. |
| Plantae | Labiatae | Salvia staminea | Ref. |
| Plantae | Lauraceae | Cinnamomum tenuifolium | Ref. |
| Plantae | Lauraceae | Machilus zuihoensis | Ref. |
| Plantae | Meliaceae | Cipadessa boivinina | Ref. |
| Plantae | Meliaceae | Trichilia estipulata | Ref. |
| Plantae | Pelliaceae | Pellia epiphylla | Ref. |
| Plantae | Pinaceae | Larix kaempferi (Lamb.) Carr | Ref. |
| Plantae | Pinaceae | Pinus koraiensis  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Pinaceae | Pseudotsuga wilsoniana | Ref. |
| Plantae | Poaceae | Zea mays L.  | Ref. |
| Plantae | Rutaceae | Boronella koniambiensis | Ref. |
| Plantae | Rutaceae | Dictamnus angustifolius | Ref. |
| Plantae | Samydaceae | Casearia membranacea | Ref. |
| Plantae | Santalaceae | Viscum coloratum  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Simaroubaceae | Quassia amara  | Ref. |
| Plantae | Taxaceae | Taxus mairei  | Ref. |
| Plantae | Zingiberaceae | Etlingera elatior  | Ref. |
| - | - | Chorisia insignis | Ref. |
| - | - | Chorisia speciosa | Ref. |
| - | - | Crotone hieronymi | Ref. |
|
|
zoom in
| Organism | Salvia bucharica | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|