| Name |
Luteolin 7-methyl ether 5,3',4'-Trihydroxy-7-methoxyflavone 7-O-Methylluteolin 2-(3,4-Dihydroxyphenyl)-5-hydroxy-7-methoxy-4H-1-benzopyran-4-one |
| Formula |
C16H12O6 |
| Mw |
300.06338812 |
| CAS RN |
20243-59-8 |
| C_ID |
C00003865
, 
|
| InChIKey |
RRRSSAVLTCVNIQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O6/c1-21-9-5-12(19)16-13(20)7-14(22-15(16)6-9)8-2-3-10(17)11(18)4-8/h2-7,17-19H,1H3 |
| SMILES |
COc1cc(O)c2c(=O)cc(-c3ccc(O)c(O)c3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Adenothamnus validus | Ref. |
| Plantae | Asteraceae | Arnica longifolia | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia barrelieri | Ref. |
| Plantae | Asteraceae | Dubautia arborea | Ref. |
| Plantae | Asteraceae | Hazardia squarrosa var. grindelioides | Ref. |
| Plantae | Asteraceae | Wunderlichia crulsiana | Ref. |
| Plantae | Boraginaceae | Heliotropium stenophyllum | Ref. |
| Plantae | Boraginaceae | Nonea lutea | Ref. |
| Plantae | Boraginaceae | Nonea pulla | Ref. |
| Plantae | Cunoniaceae | Eucryphia jinksii | Ref. |
| Plantae | Cunoniaceae | Eucryphia lucida | Ref. |
| Plantae | Labiatae | Origanum calcaratum | Ref. |
| Plantae | Labiatae | Origanum dictamnus  | Ref. |
| Plantae | Labiatae | Origanum floribundum | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Labiatae | Origanum microphyllum | Ref. |
| Plantae | Labiatae | Origanum onites  | Ref. |
| Plantae | Labiatae | Origanum syriacum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Glandulosum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Hirtum  | Ref. |
| Plantae | Labiatae | Salvia euphratica | Ref. |
| Plantae | Labiatae | Salvia hypoleuca | Ref. |
| Plantae | Labiatae | Salvia lavandulaefolia | Ref. |
| Plantae | Labiatae | Salvia moorcroftiana  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Salvia sclarea  | Ref. |
| Plantae | Labiatae | Sideritis spp. | Ref. |
| Plantae | Labiatae | Teucrium marum  | Ref. |
| Plantae | Labiatae | Thymus membranaceus | Ref. |
| Plantae | Plantaginaceae | Antirrhinum spp. | Ref. |
| Plantae | Poaceae | Sorghum durra | Ref. |
| Plantae | Pteridaceae | Notholaena californica | Ref. |
| Plantae | Solanaceae | Petunia parviflora | Ref. |
| Plantae | Thymelaeaceae | Daphne sericea | Ref. |
|
|
zoom in
| Organism | Origanum vulgare subsp. Glandulosum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|