| Name |
Ladanein |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
10176-71-3 |
| C_ID |
C00003839
, 
|
| InChIKey |
UUQJTIHOVGMQIH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O6/c1-21-10-5-3-9(4-6-10)12-7-11(18)15-13(23-12)8-14(22-2)16(19)17(15)20/h3-8,19-20H,1-2H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)c(O)c(OC)cc3o2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia argyi  | Ref. |
| Plantae | Asteraceae | Artemisia aygyi | Ref. |
| Plantae | Asteraceae | Baccharis tucumanensis | Ref. |
| Plantae | Asteraceae | Pulicaria paludosa | Ref. |
| Plantae | Bignoniaceae | Catalpa bignonioides | Ref. |
| Plantae | Labiatae | Ballota hirsuta | Ref. |
| Plantae | Labiatae | Marrubium thessalum | Ref. |
| Plantae | Labiatae | Marrubium trachyticum | Ref. |
| Plantae | Labiatae | Mentha piperita  | Ref. |
| Plantae | Labiatae | Micromeria albanica | Ref. |
| Plantae | Labiatae | Nepeta pungens | Ref. |
| Plantae | Labiatae | Nepeta saturejoides | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Ocimum spp. | Ref. |
| Plantae | Labiatae | Origanum calcaratum | Ref. |
| Plantae | Labiatae | Origanum dictamnus  | Ref. |
| Plantae | Labiatae | Origanum floribundum | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Labiatae | Origanum microphyllum | Ref. |
| Plantae | Labiatae | Origanum onites  | Ref. |
| Plantae | Labiatae | Origanum syriacum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Glandulosum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Hirtum  | Ref. |
| Plantae | Labiatae | Orthosiphon stamineus  | Ref. |
| Plantae | Labiatae | Salvia cyanescens | Ref. |
| Plantae | Labiatae | Salvia hypoleuca | Ref. |
| Plantae | Labiatae | Salvia stenophylla  | Ref. |
| Plantae | Labiatae | Salvia syriaca | Ref. |
| Plantae | Labiatae | Thymus piperella  | Ref. |
|
|
zoom in
| Organism | Origanum onites | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|