| Name |
Shikimic acid Shikimatic acid |
| Formula |
C7H10O5 |
| Mw |
174.05282343 |
| CAS RN |
138-59-0 |
| C_ID |
C00001203
, 
|
| InChIKey |
JXOHGGNKMLTUBP-KFVSRLJTNA-N |
| InChICode |
InChI=1S/C7H10O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1,4-6,8-10H,2H2,(H,11,12)/t4-,5-,6-/m1/s1 |
| SMILES |
O=C(O)C1=C[C@@H](O)[C@@H](O)[C@H](O)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Alicyclobacillaceae | Alicyclobacillus acidocaldarius | Ref. |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Bacteria | Streptomycetaceae | Streptomyces collinus | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Dennstaedtiaceae | Pteridium aquilinum  | Ref. |
| Plantae | Euphorbiaceae | Excoecaria cochinchinensis var.viridis  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Geraniaceae | Pelargonium sidoides  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Gleicheniaceae | Dicranopteris pedata | Ref. |
| Plantae | Hydrangeaceae | Hydrangea chinensis | Ref. |
| Plantae | Hypericaceae | Hypericum beanii | Ref. |
| Plantae | Illiciaceae | Illicium minwanense | Ref. |
| Plantae | Illiciaceae | Illicium religiosum | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Lythraceae | Punica granatum L.  | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Zingiberaceae | Curcuma domestica  | Ref. |
|
|
zoom in
| Organism | Illicium minwanense | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Wang, et al., APS, 29, (1994), 693.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
YUAN, et al., Chem Pharm Bull, 53, (2005), 1610 |
|---|
|