| Name |
Methyl salicylate |
| Formula |
C8H8O3 |
| Mw |
152.04734412 |
| CAS RN |
119-36-8 |
| C_ID |
C00030767
, 
|
| InChIKey |
OSWPMRLSEDHDFF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H8O3/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5,9H,1H3 |
| SMILES |
COC(=O)c1ccccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Boletaceae | Boletus edulis  | Ref. |
| Plantae | Anacardiaceae | Anacardium occidentale  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apocynaceae | Beaumontia grandiflora | Ref. |
| Plantae | Asteraceae | Artemisia annua L.cultivar Jwarharti  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Canellaceae | Canella winterana  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Caryophyllaceae | Dianthus superbus  | Ref. |
| Plantae | Caryophyllaceae | Silene latifolia  | Ref. |
| Plantae | Caryophyllales | Beta vulgaris  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica rapa  | Ref. |
| Plantae | Cruciferae | Hesperis matronalis  | Ref. |
| Plantae | Ericaceae | Gaultheria procumbens  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Myrtaceae | Syzygium aromaticum  | Ref. |
| Plantae | Oleaceae | Nyctanthes arbor-tristis Linn.  | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rubiaceae | Coffea arabica  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Nicotiana langsdorffii | Ref. |
| Plantae | Solanaceae | Nicotiana mutabilis | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum peruvianum | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Taxaceae | Taxus wallichiana  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | Proteaceae | Ref. |
|
|
zoom in
| Organism | Morus alba | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Xie, et al., Chapter 28, JIU LI XIANG, in Modern Stydies of Chinese Herbal Medicine, edited. By Institute of Materia Medica, Chinese Academy of Medical Sciences, Vol.2, 333-61, Union Press of Beijing Medical University and Peking Union Medical College, Geijing, (1996) |
|---|
|