| Name |
N-Methyltyramine |
| Formula |
C9H13NO |
| Mw |
151.09971404 |
| CAS RN |
370-98-9 |
| C_ID |
C00027432
, 
|
| InChIKey |
AXVZFRBSCNEKPQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C9H13NO/c1-10-7-6-8-2-4-9(11)5-3-8/h2-5,10-11H,6-7H2,1H3 |
| SMILES |
CNCCc1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe ballyi  | Ref. |
| Plantae | Asphodelaceae | Aloe deltoideodonta | Ref. |
| Plantae | Asphodelaceae | Aloe gillilandii | Ref. |
| Plantae | Asphodelaceae | Aloe ibitiensis | Ref. |
| Plantae | Asphodelaceae | Aloe ruspoliana | Ref. |
| Plantae | Asphodelaceae | Aloe spp.  | Ref. |
| Plantae | Asphodelaceae | Aloe viguieri | Ref. |
| Plantae | Cactaceae | Ariocarpus kotschoubeyanus | Ref. |
| Plantae | Cactaceae | Ariocarpus scapharostrus | Ref. |
| Plantae | Cactaceae | Espostoa huanucensis | Ref. |
| Plantae | Cactaceae | Mammillaria microcarpa | Ref. |
| Plantae | Cactaceae | Trichocereus candicans | Ref. |
| Plantae | Cactaceae | Trichocereus spachianus | Ref. |
| Plantae | Cactaceae | Turbinicarpus alonsoi | Ref. |
| Plantae | Fabaceae | Acacia rigidula Benth. | Ref. |
| Plantae | Fabaceae | Desmodium gangeticum  | Ref. |
| Plantae | Fabaceae | Prosopis glandulosa  | Ref. |
| Plantae | Poaceae | Panicum miliaceum  | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Citrus chachiensis | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Citrus wilsonii | Ref. |
| Plantae | Rutaceae | Poncirus trifoliata  | Ref. |
| - | - | Lobivia bachenbergii | Ref. |
| - | - | Lobivia binghamiana | Ref. |
| - | - | Lobivia pentlandii | Ref. |
| - | - | Pseudolobivia kermesina | Ref. |
| - | - | Testulea gabonensis | Ref. |
|
|
zoom in
| Organism | Citrus aurantium | | Reference | Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|