| Name |
Lupenone |
| Formula |
C30H48O |
| Mw |
424.37051615 |
| CAS RN |
1617-70-5 |
| C_ID |
C00019220
, 
|
| InChIKey |
GRBHNQFQFHLCHO-DYWULMQRNA-N |
| InChICode |
InChI=1S/C30H48O/c1-19(2)20-11-14-27(5)17-18-29(7)21(25(20)27)9-10-23-28(6)15-13-24(31)26(3,4)22(28)12-16-30(23,29)8/h20-23,25H,1,9-18H2,2-8H3/t20-,21+,22-,23+,25-,27+,28-,29+,30+/m0/s1 |
| SMILES |
C=C(C)[C@@H]1CC[C@]2(C)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Strobilanthes cusia  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Asteraceae | Chuquiraga ulicina ssp. ulicina | Ref. |
| Plantae | Asteraceae | Scorzonera cretica | Ref. |
| Plantae | Asteraceae | Senecio chionophilus | Ref. |
| Plantae | Betulaceae | Alnus japonica  | Ref. |
| Plantae | Celastraceae | Celastrus hindsii BENTH | Ref. |
| Plantae | Celastraceae | Maytenus chiapensis | Ref. |
| Plantae | Celastraceae | Maytenus cuzcoina | Ref. |
| Plantae | Combretaceae | Terminalia brasiliensis | Ref. |
| Plantae | Ebenaceae | Diospyros mollis  | Ref. |
| Plantae | Ebenaceae | Diospyros rhodocalyx | Ref. |
| Plantae | Euphorbiaceae | Croton arboreous | Ref. |
| Plantae | Euphorbiaceae | Euphorbia helioscopia  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia segetalis  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia stygiana | Ref. |
| Plantae | Euphorbiaceae | Manihot esculenta  | Ref. |
| Plantae | Fabaceae | Acacia mellifera  | Ref. |
| Plantae | Fabaceae | Acacia pennatula | Ref. |
| Plantae | Fabaceae | Albizia gummifera  | Ref. |
| Plantae | Fabaceae | Anadenanthera colubrine | Ref. |
| Plantae | Fabaceae | Derris oblonga | Ref. |
| Plantae | Fabaceae | Millettia pinnata | Ref. |
| Plantae | Fabaceae | Piptadenia macrocarpa | Ref. |
| Plantae | Fabaceae | Pongamia pinnata  | Ref. |
| Plantae | Fabaceae | Pterocarpus santalinus  | Ref. |
| Plantae | Fabaceae | Tephrosia toxicaria | Ref. |
| Plantae | Fabaceae | Tephrosia villosa  | Ref. |
| Plantae | Lardizabalaceae | Stauntonia obovatifoliola Hayata subsp.intermedia | Ref. |
| Plantae | Lauraceae | Neolitsea konishii | Ref. |
| Plantae | Lauraceae | Neolitsea parvigemma | Ref. |
| Plantae | Malvaceae | Firmiana simplex  | Ref. |
| Plantae | Meliaceae | Aglaia forbesii  | Ref. |
| Plantae | Phyllanthaceae | Glochidion puberum | Ref. |
| Plantae | Rhizophoraceae | Bruguiera parviflora  | Ref. |
| Plantae | Rubiaceae | Lasianthus gardneri | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Rutaceae | Phellodendron japonicum MAXIM | Ref. |
|
|
zoom in
| Organism | Acacia pennatula | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|