| Name |
(+)-Cuparene Cuparene (R)-1-Methyl-4-(1,2,2-trimethylcyclopentyl)-benzene (R)-Cuparene |
| Formula |
C15H22 |
| Mw |
202.1721507 |
| CAS RN |
16982-00-6 |
| C_ID |
C00012508
, 
|
| InChIKey |
SLKPBCXNFNIJSV-GGYSOQFKNA-N |
| InChICode |
InChI=1S/C15H22/c1-12-6-8-13(9-7-12)15(4)11-5-10-14(15,2)3/h6-9H,5,10-11H2,1-4H3/t15-/m0/s1 |
| SMILES |
Cc1ccc([C@]2(C)CCCC2(C)C)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Ganodermataceae | Ganoderma lucidum  | Ref. |
| Plantae | Annonaceae | Cananga odorata  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Aytoniaceae | Reboulia hemisphaerica | Ref. |
| Plantae | Cupressaceae | Biota orientalis | Ref. |
| Plantae | Cupressaceae | Chamaecyparis thyoides | Ref. |
| Plantae | Cupressaceae | Widdringtonia juniperoides | Ref. |
| Plantae | Cupressaceae | Widdringtonia schwartzii | Ref. |
| Plantae | Cupressaceae | Widdringtonia whytei | Ref. |
| Plantae | Gymnomitriaceae | Marsupella emarginata | Ref. |
| Plantae | Jubulaceae | Frullania falciloba | Ref. |
| Plantae | Jubulaceae | Frullania probosciphora | Ref. |
| Plantae | Jubulaceae | Frullania squarrosula | Ref. |
| Plantae | Jungermanniaceae | Jungermannia infusca | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Lepidoziaceae | Bazzania pompeana | Ref. |
| Plantae | Lepidoziaceae | Bazzania trilobata L. | Ref. |
| Plantae | Lepidoziaceae | Lepidozia vitrea | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Gymnomitrion obtusum Lindb | Ref. |
|
|
zoom in
| Organism | Zingiber officinale | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|