| Name |
Verminoside (-)-Verminoside |
| Formula |
C24H28O13 |
| Mw |
524.15299098 |
| CAS RN |
50932-19-9 |
| C_ID |
C00010521
, 
|
| InChIKey |
MZQXNUBTVLKMLP-LALIWZIRNA-N |
| InChICode |
InChI=1S/C24H28O13/c25-8-14-17(30)18(31)19(32)23(34-14)36-22-16-11(5-6-33-22)20(21-24(16,9-26)37-21)35-15(29)4-2-10-1-3-12(27)13(28)7-10/h1-7,11,14,16-23,25-28,30-32H,8-9H2/b4-2+/t11-,14+,16+,17+,18+,19-,20-,21-,22-,23-,24+/m0/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)c(O)c1)O[C@H]1[C@@H]2C=CO[C@@H](O[C@@H]3OC(CO)[C@@H](O)C(O)[C@@H]3O)[C@@H]2[C@@]2(CO)O[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Bignoniaceae | Kigelia africana  | Ref. |
| Plantae | Bignoniaceae | Kigelia pinnata DC.  | Ref. |
| Plantae | Bignoniaceae | Stereospermum cylindricum  | Ref. |
| Plantae | Plantaginaceae | Picrorhiza scrophulariiflora  | Ref. |
| Plantae | Plantaginaceae | Veronica anagallis-aquatica  | Ref. |
| Plantae | Plantaginaceae | Veronica bellidioides | Ref. |
| Plantae | Plantaginaceae | Veronica cuneifolia | Ref. |
| Plantae | Plantaginaceae | Veronica cymbalaria | Ref. |
| Plantae | Plantaginaceae | Veronica hederifolia | Ref. |
| Plantae | Plantaginaceae | Veronica ligustrifolia A.Cunn | Ref. |
| Plantae | Plantaginaceae | Veronica montana | Ref. |
| Plantae | Plantaginaceae | Veronica officinalis  | Ref. |
| Plantae | Plantaginaceae | Veronica perfoliata | Ref. |
| Plantae | Plantaginaceae | Veronica persica  | Ref. |
| Plantae | Plantaginaceae | Veronica polita | Ref. |
| Plantae | Plantaginaceae | Veronica salicifolia G. Forst. | Ref. |
| Plantae | Plantaginaceae | Veronica spuria | Ref. |
| Plantae | Plantaginaceae | Veronica x andersonii Lindl. et Pax | Ref. |
| - | - | Vernoica cymbalaria | Ref. |
|
|
zoom in
| Organism | Vernoica cymbalaria | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|