| Name |
9-O-Methylcoumestrol 4'-O-Methylcoumestrol 3-Hydroxy-9-methoxycoumestan |
| Formula |
C16H10O5 |
| Mw |
282.05282343 |
| CAS RN |
1690-62-6 |
| C_ID |
C00009757
, 
|
| InChIKey |
HHEZPZWGHDOWCQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H10O5/c1-19-9-3-5-10-13(7-9)20-15-11-4-2-8(17)6-12(11)21-16(18)14(10)15/h2-7,17H,1H3 |
| SMILES |
COc1ccc2c(c1)oc1c3ccc(O)cc3oc(=O)c21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Cicer anatolicum | Ref. |
| Plantae | Fabaceae | Cicer arietinum  | Ref. |
| Plantae | Fabaceae | Cicer canariensis | Ref. |
| Plantae | Fabaceae | Cicer chorassanicum | Ref. |
| Plantae | Fabaceae | Cicer cuneatum | Ref. |
| Plantae | Fabaceae | Cicer echinospermum | Ref. |
| Plantae | Fabaceae | Cicer microphyllum | Ref. |
| Plantae | Fabaceae | Cicer nuristanicum | Ref. |
| Plantae | Fabaceae | Cicer oxyodon | Ref. |
| Plantae | Fabaceae | Cicer reticulatum | Ref. |
| Plantae | Fabaceae | Cicer yamashitae | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Dalbergia oliveri | Ref. |
| Plantae | Fabaceae | Dalbergia stevensonii | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Melilotus messanensis | Ref. |
| Plantae | Fabaceae | Myroxylon balsamum  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Trifolium repens  | Ref. |
|
|
zoom in
| Organism | Trifolium pratense | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Francis,Aust.J.Agric.Res.,22,(1971),75
Bickoff,J.Agric.Food Chem.,13,(1965),597 |
|---|
|