| Name |
kaempferol 3-O-robinobioside Kaempferol 3-robinobioside Biorobin Kaempferol 3-O-robinoside |
| Formula |
C27H30O15 |
| Mw |
594.15847029 |
| CAS RN |
17297-56-2 |
| C_ID |
C00005160
, 
|
| InChIKey |
RTATXGUCZHCSNG-LRUFOLOENA-N |
| InChICode |
InChI=1S/C27H30O15/c1-9-17(31)20(34)22(36)26(39-9)38-8-15-18(32)21(35)23(37)27(41-15)42-25-19(33)16-13(30)6-12(29)7-14(16)40-24(25)10-2-4-11(28)5-3-10/h2-7,9,15,17-18,20-23,26-32,34-37H,8H2,1H3/t9-,15-,17-,18-,20-,21-,22+,23-,26+,27-/m0/s1 |
| SMILES |
CC1O[C@@H](OCC2O[C@@H](Oc3c(-c4ccc(O)cc4)oc4cc(O)cc(O)c4c3=O)C(O)C(O)[C@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Actinidiaceae | Actinidia spp. | Ref. |
| Plantae | Annonaceae | Annona muricata  | Ref. |
| Plantae | Chenopodiaceae | Chenopodium fremontii | Ref. |
| Plantae | Chenopodiaceae | Chenopodium pallidicaule | Ref. |
| Plantae | Fabaceae | Clitoria ternatea  | Ref. |
| Plantae | Fabaceae | Lathyrus articulatus | Ref. |
| Plantae | Fabaceae | Lathyrus clymenum  | Ref. |
| Plantae | Fabaceae | Lespedeza juncea | Ref. |
| Plantae | Fabaceae | Medicago spp. | Ref. |
| Plantae | Fabaceae | Medicago spp., | Ref. |
| Plantae | Fabaceae | Robinia neomexicana | Ref. |
| Plantae | Fabaceae | Robinia pseudoacacia  | Ref. |
| Plantae | Fabaceae | Trigonella spicata | Ref. |
| Plantae | Fabaceae | Trigonella spp. | Ref. |
| Plantae | Longaniaceae | Strychnos variabilis | Ref. |
| Plantae | Polygalaceae | Monnina sylvatica | Ref. |
| Plantae | Polygonaceae | Rumex chalepensis | Ref. |
| Plantae | Primulaceae | Primula officinalis  | Ref. |
| Plantae | Rhamnaceae | Rhamnus disperma | Ref. |
| Plantae | Solanaceae | Atropa belladonna  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Physalis peruviana  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
|
|
zoom in
| Organism | Rhamnus disperma | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|