| Name |
Kaempferol 7-O-rhamnoside Kaempferol 7-O-alpha-L-rhamnopyranoside Kaempferol 7-rhamnoside Kaempferol-7-rhamnoside |
| Formula |
C21H20O10 |
| Mw |
432.10564686 |
| CAS RN |
20196-89-8 |
| C_ID |
C00005150
, 
|
| InChIKey |
HQNOUCSPWAGQND-OKBQHECNNA-N |
| InChICode |
InChI=1S/C21H20O10/c1-8-15(24)17(26)19(28)21(29-8)30-11-6-12(23)14-13(7-11)31-20(18(27)16(14)25)9-2-4-10(22)5-3-9/h2-8,15,17,19,21-24,26-28H,1H3/t8-,15-,17-,19+,21-/m0/s1 |
| SMILES |
CC1O[C@@H](Oc2cc(O)c3c(=O)c(O)c(-c4ccc(O)cc4)oc3c2)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Eupatorium hookerianum | Ref. |
| Plantae | Cactaceae | Cephalocereus senilis | Ref. |
| Plantae | Celastraceae | Celastrus orbiculatus  | Ref. |
| Plantae | Chenopodiaceae | Chenopodium ambrosioides  | Ref. |
| Plantae | Chenopodiaceae | Chenopodium murale  | Ref. |
| Plantae | Crassulaceae | Hylotelephium mingiinianum | Ref. |
| Plantae | Crassulaceae | Rhodiola crenulata | Ref. |
| Plantae | Crassulaceae | Sedum ewersii | Ref. |
| Plantae | Crassulaceae | Sedum telephium  | Ref. |
| Plantae | Crassulaceae | Sinocrassula indica  | Ref. |
| Plantae | Cruciferae | Matthiola incana R.Br.  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cucurbitaceae | Siraitia grosvenori | Ref. |
| Plantae | Dryopteridaceae | Dryopteris crassirhizoma | Ref. |
| Plantae | Equisetaceae | Equisetum palustre | Ref. |
| Plantae | Equisetaceae | Equisetum silvaticum | Ref. |
| Plantae | Equisetaceae | Equisetum telmateja | Ref. |
| Plantae | Euphorbiaceae | Euphorbia lanata | Ref. |
| Plantae | Fabaceae | Lotus corniculatus  | Ref. |
| Plantae | Fabaceae | Macroptilium spp. | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Oxytropis glabra | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Robinia neomexicana | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Vigna luteola | Ref. |
| Plantae | Fabaceae | Vigna mungo  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Liliaceae | Lilium regale | Ref. |
| Plantae | Platanaceae | Platanus acerifolia | Ref. |
| Plantae | Ranunculaceae | Delphinium formosum | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
|
|
zoom in
| Organism | Lotus corniculatus | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Asen,Proc.Am.Soc.Hortic.Sci.,81,(1962),530
Geiger,Phytochem.,17,(1978),336 |
|---|
|