| Name |
Monotropein |
| Formula |
C16H22O11 |
| Mw |
390.11621155 |
| CAS RN |
5945-50-6 |
| C_ID |
C00003089
, 
|
| InChIKey |
HPWWQPXTUDMRBI-LJIQLVJANA-N |
| InChICode |
InChI=1S/C16H22O11/c17-3-8-10(19)11(20)12(21)15(26-8)27-14-9-6(1-2-16(9,24)5-18)7(4-25-14)13(22)23/h1-2,4,6,8-12,14-15,17-21,24H,3,5H2,(H,22,23)/t6-,8+,9+,10+,11-,12+,14-,15-,16+/m0/s1 |
| SMILES |
O=C(O)C1=CO[C@@H](O[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)[C@H]2[C@@H]1C=C[C@]2(O)CO |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus suecica  | Ref. |
| Plantae | Ericaceae | Arctostaphylos uva-ursi  | Ref. |
| Plantae | Ericaceae | Monotropa hypopithys | Ref. |
| Plantae | Ericaceae | Monotropa hypopitys | Ref. |
| Plantae | Ericaceae | Monotropa uniflora  | Ref. |
| Plantae | Ericaceae | Pyrola elliptica | Ref. |
| Plantae | Ericaceae | Pyrola japonica  | Ref. |
| Plantae | Ericaceae | Pyrola renifolia | Ref. |
| Plantae | Ericaceae | Pyrola spp. | Ref. |
| Plantae | Ericaceae | Vaccinium spp. | Ref. |
| Plantae | Globulariaceae | Globularia spp. | Ref. |
| Plantae | Hamamelidaceae | Liquidambar orientalis  | Ref. |
| Plantae | Hamamelidaceae | Liquidambar spp. | Ref. |
| Plantae | Hamamelidaceae | Liquidambar styraciflua  | Ref. |
| Plantae | Rubiaceae | Asperula spp. | Ref. |
| Plantae | Rubiaceae | Galium glaucum | Ref. |
| Plantae | Rubiaceae | Galium rivale | Ref. |
| Plantae | Rubiaceae | Galium spp. | Ref. |
| Plantae | Rubiaceae | Morinda citrifolia  | Ref. |
| Plantae | Rubiaceae | Morinda officinalis  | Ref. |
| Plantae | Rubiaceae | Saprosma scortechinii | Ref. |
|
|
zoom in
| Organism | Morinda citrifolia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|