| Name |
Malvin Malvidin 3,5-diglucoside Malvidin diglucoside |
| Formula |
C29H35O17 |
| Mw |
655.1874247 |
| CAS RN |
16727-30-3 |
| C_ID |
C00002384
, 
|
| InChIKey |
CILLXFBAACIQNS-OQSXKAOHNA-O |
| InChICode |
InChI=1S/C29H34O17/c1-40-15-3-10(4-16(41-2)20(15)33)27-17(44-29-26(39)24(37)22(35)19(9-31)46-29)7-12-13(42-27)5-11(32)6-14(12)43-28-25(38)23(36)21(34)18(8-30)45-28/h3-7,18-19,21-26,28-31,34-39H,8-9H2,1-2H3,(H-,32,33)/p+1/t18-,19+,21+,22+,23-,24-,25+,26+,28+,29+/m0/s1 |
| SMILES |
COc1cc(-c2[o+]c3cc(O)cc(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)c3cc2O[C@@H]2OC(CO)[C@@H](O)C(O)C2O)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium cepa  | Ref. |
| Plantae | Balsaminaceae | Impatiens balsamina  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea tryphida | Ref. |
| Plantae | Fabaceae | Astragalus sinicus | Ref. |
| Plantae | Fabaceae | Canavalia lineata | Ref. |
| Plantae | Fabaceae | Cercis chinensis | Ref. |
| Plantae | Fabaceae | Desmodium sandwicense | Ref. |
| Plantae | Fabaceae | Dicorynia guianensis | Ref. |
| Plantae | Fabaceae | Hedysarum coronarium  | Ref. |
| Plantae | Fabaceae | Indigofera pseudotinctoria | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Millettia zechiana | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Vicia sativa  | Ref. |
| Plantae | Fabaceae | Vicia unijuga  | Ref. |
| Plantae | Fabaceae | Vicia venosa | Ref. |
| Plantae | Fabaceae | Wisteria floribunda  | Ref. |
| Plantae | Geraniaceae | Geranium eriostemon | Ref. |
| Plantae | Geraniaceae | Geranium sylvaticum | Ref. |
| Plantae | Geraniaceae | Pelargonium dolomiticum | Ref. |
| Plantae | Malvaceae | Malva sylvestris  | Ref. |
| Plantae | Melastomataceae | Melastoma malabathricum  | Ref. |
| Plantae | Myrsinaceae | Cyclamen persicum  | Ref. |
| Plantae | Myrtaceae | Metrosideros spp. | Ref. |
| Plantae | Onagraceae | Fuchsia spp. | Ref. |
| Plantae | Passifloraceae | Passiflora quadrangularis  | Ref. |
| Plantae | Polygonaceae | Polygonum spp. | Ref. |
| Plantae | Saxifragaceae | Saxifraga spp. | Ref. |
| Plantae | Vitaceae | Ampelopsis brevipedunculata  | Ref. |
| Plantae | Vitaceae | Vitis spp.  | Ref. |
|
|
zoom in
| Organism | Geranium eriostemon | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Willstatter,Ann.,408,(1915),122 |
|---|
|