| Name |
3-Methylbutanoic acid 3-Methylbutyric acid Isovaleric acid |
| Formula |
C5H10O2 |
| Mw |
102.06807956 |
| CAS RN |
503-74-2 |
| C_ID |
C00001189
, 
|
| InChIKey |
GWYFCOCPABKNJV-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C5H10O2/c1-4(2)3-5(6)7/h4H,3H2,1-2H3,(H,6,7) |
| SMILES |
CC(C)CC(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Skin) | Ref. |
| Animalia | Hominidae | Homo sapiens (Skin microbiota) | Ref. |
| Bacteria | Staphylococcaceae | Staphylococcus aureus | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Asteraceae | Achillea millefolium  | Ref. |
| Plantae | Asteraceae | Arctium lappa  | Ref. |
| Plantae | Asteraceae | Carthamus tinctorius  | Ref. |
| Plantae | Asteraceae | Centaurea orientalis | Ref. |
| Plantae | Boraginaceae | Lithospermum erythrorhizon  | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Celastraceae | Euonymus japonicus  | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Labiatae | Elsholtzia ciliata  | Ref. |
| Plantae | Lauraceae | Litsea cubeba  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Plantaginaceae | Plantago lanceolata  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rubiaceae | Coffea arabica  | Ref. |
| Plantae | Saxifragaceae | Saxifraga stolonifera Meerb.  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Valerianaceae | Nardostachys chinensis  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana spp. | Ref. |
| - | - | Delphinus delphis | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Plantago lanceolata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|