| Name |
Delphinidin |
| Formula |
C15H11O7 |
| Mw |
303.05047771 |
| CAS RN |
13270-61-6 |
| C_ID |
C00052959
|
| InChIKey |
JKHRCGUTYDNCLE-UHFFFAOYSA-O |
| InChICode |
InChI=1S/C15H10O7/c16-7-3-9(17)8-5-12(20)15(22-13(8)4-7)6-1-10(18)14(21)11(19)2-6/h1-5H,(H5-,16,17,18,19,20,21)/p+1 |
| SMILES |
Oc1cc(O)c2cc(O)c(-c3cc(O)c(O)c(O)c3)[o+]c2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Fabaceae | Medicago arabica | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Lythraceae | Punica granatum L.  | Ref. |
| Plantae | Plantaginaceae | Antirrhinum majus  | Ref. |
| Plantae | Poaceae | Zea mays  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Petunia hybrida | Ref. |
| Plantae | Solanaceae | Solanum tuberosum subsp. Andigena  | Ref. |
| Plantae | Staphyleaceae | Euscaphis konishii | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| Plantae | Zingiberaceae | Zingiber mioga  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Nympaea spp. | Ref. |
|
|
zoom in
| Organism | Zingiber mioga | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|