| Name |
Methyl benzoate |
| Formula |
C8H8O2 |
| Mw |
136.0524295 |
| CAS RN |
93-58-3 |
| C_ID |
C00034054
, 
|
| InChIKey |
QPJVMBTYPHYUOC-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H8O2/c1-10-8(9)7-5-3-2-4-6-7/h2-6H,1H3 |
| SMILES |
COC(=O)c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Annona cherimola  | Ref. |
| Plantae | Araceae | Monstera deliciosa  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Caryophyllaceae | Silene latifolia  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica rapa  | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| Plantae | Nymphaeaceae | Nymphaea lasiophylla | Ref. |
| Plantae | Oleaceae | Jasminum grandiflorum  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Salviniaceae | Salvinia molesta D.S.Mitch. | Ref. |
| Plantae | Solanaceae | Nicotiana bonariensis | Ref. |
| Plantae | Solanaceae | Nicotiana cavicola  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Taxaceae | Taxus wallichiana  | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | Proteaceae | Ref. |
|
|
zoom in
| Organism | Taxus wallichiana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|