| Name |
Friedelanol Friedelinol Friedelan-3alpha-ol |
| Formula |
C30H52O |
| Mw |
428.40181628 |
| CAS RN |
5085-72-3 |
| C_ID |
C00031793
, 
|
| InChIKey |
XCDQFROEGGNAER-VYFOYESCSA-N |
| InChICode |
InChI=1S/C30H52O/c1-20-21(31)9-10-22-27(20,5)12-11-23-28(22,6)16-18-30(8)24-19-25(2,3)13-14-26(24,4)15-17-29(23,30)7/h20-24,31H,9-19H2,1-8H3/t20-,21+,22+,23-,24+,26+,27+,28-,29+,30-/m0/s1 |
| SMILES |
C[C@H]1[C@H](O)CC[C@@H]2[C@]1(C)CC[C@H]1[C@@]2(C)CC[C@@]2(C)[C@@H]3CC(C)(C)CC[C@]3(C)CC[C@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Goniothalamus thwaitesii | Ref. |
| Plantae | Asteraceae | Chuquiraga ulicina ssp. ulicina | Ref. |
| Plantae | Asteraceae | Doellingeria scaber | Ref. |
| Plantae | Asteraceae | Eupatorium azureum | Ref. |
| Plantae | Asteraceae | Eupatorium riparium | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum thwaitesii | Ref. |
| Plantae | Celastraceae | Celastrus hindsii BENTH | Ref. |
| Plantae | Celastraceae | Euonymus japonica | Ref. |
| Plantae | Convolvulaceae | Argyreia populifolia | Ref. |
| Plantae | Convolvulaceae | Argyreia speciosa  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia antiquorum  | Ref. |
| Plantae | Euphorbiaceae | Macaranga tanarius | Ref. |
| Plantae | Hydrangeaceae | Pileostegia viburnoides var. glabrescens | Ref. |
| Plantae | Hypericaceae | Hypericum ascyron  | Ref. |
| Plantae | Moraceae | Ficus nitida | Ref. |
| Plantae | Phyllanthaceae | Bischofia javanica  | Ref. |
| Plantae | Plumbaginaceae | Plumbago zeylanica  | Ref. |
| Plantae | Polygonaceae | Polygonum bistorta  | Ref. |
| - | - | Balanops australiana | Ref. |
| - | - | Bishofia javanica | Ref. |
| - | - | Gymnaster koraiensis | Ref. |
|
|
zoom in
| Organism | Polygonum bistorta | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|