| Name |
Echinatine (+)-Echinatine |
| Formula |
C15H25NO5 |
| Mw |
299.17327292 |
| CAS RN |
480-83-1 |
| C_ID |
C00026189
, 
|
| InChIKey |
SFVVQRJOGUKCEG-WQPDCJPXNA-N |
| InChICode |
InChI=1S/C15H25NO5/c1-9(2)15(20,10(3)17)14(19)21-8-11-4-6-16-7-5-12(18)13(11)16/h4,9-10,12-13,17-18,20H,5-8H2,1-3H3/t10-,12-,13+,15-/m0/s1 |
| SMILES |
CC(C)[C@@](O)(C(=O)OCC1=CCN2CC[C@H](O)[C@@H]12)[C@H](C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Ala L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Asteraceae | Eupatorium cannabinum L.  | Ref. |
| Plantae | Asteraceae | Eupatorium maculatum | Ref. |
| Plantae | Asteraceae | Eupatorium portoricense Urban | Ref. |
| Plantae | Boraginaceae | Cynoglossum amabile | Ref. |
| Plantae | Boraginaceae | Cynoglossum furcatum | Ref. |
| Plantae | Boraginaceae | Cynoglossum officinale  | Ref. |
| Plantae | Boraginaceae | Cynoglossum pictum Ait. | Ref. |
| Plantae | Boraginaceae | Heliotropium circinatum | Ref. |
| Plantae | Boraginaceae | Heliotropium indicum  | Ref. |
| Plantae | Boraginaceae | Heliotropium supinum | Ref. |
| Plantae | Boraginaceae | Lindelofia angustifolia | Ref. |
| Plantae | Boraginaceae | Lindelofia stylosa | Ref. |
| Plantae | Boraginaceae | Rindera austroechinata | Ref. |
| Plantae | Boraginaceae | Solenanthus coronatus | Ref. |
| Plantae | Boraginaceae | Symphytum asperum | Ref. |
| Plantae | Boraginaceae | Symphytum caucasicum | Ref. |
| Plantae | Boraginaceae | Symphytum caucasium | Ref. |
| Plantae | Boraginaceae | Symphytum officinale  | Ref. |
| Plantae | Boraginaceae | Symphytum officinalis | Ref. |
| - | - | Paracynoglossum imeretinum | Ref. |
|
|
zoom in
| Organism | Symphytum caucasium | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|