| Name |
Medicagol 3-Hydroxy-8,9-methylenedioxycoumestan 7-Hydroxy-11,12-methylenedioxycoumestan |
| Formula |
C16H8O6 |
| Mw |
296.03208799 |
| CAS RN |
1983-72-8 |
| C_ID |
C00009760
, 
|
| InChIKey |
URMVEUAWRUQHON-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H8O6/c17-7-1-2-8-10(3-7)22-16(18)14-9-4-12-13(20-6-19-12)5-11(9)21-15(8)14/h1-5,17H,6H2 |
| SMILES |
O=c1oc2cc(O)ccc2c2oc3cc4c(cc3c12)OCO4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Cicer anatolicum | Ref. |
| Plantae | Fabaceae | Cicer arietinum  | Ref. |
| Plantae | Fabaceae | Cicer bijugum | Ref. |
| Plantae | Fabaceae | Cicer canariensis | Ref. |
| Plantae | Fabaceae | Cicer chorassanicum | Ref. |
| Plantae | Fabaceae | Cicer cuneatum | Ref. |
| Plantae | Fabaceae | Cicer echinospermum | Ref. |
| Plantae | Fabaceae | Cicer judicum | Ref. |
| Plantae | Fabaceae | Cicer macracanthum | Ref. |
| Plantae | Fabaceae | Cicer oxyodon | Ref. |
| Plantae | Fabaceae | Cicer pinnatifidum | Ref. |
| Plantae | Fabaceae | Cicer yamashitae | Ref. |
| Plantae | Fabaceae | Dalbergia oliveri | Ref. |
| Plantae | Fabaceae | Dalbergia stevensonii | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Sophora tetraptera  | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
|
|
zoom in
| Organism | Trifolium pratense | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Livingston,J.Org.Chem.,30,(1965),2353
Zilg,Phytochem.,8,(1969),2261 |
|---|
|