| Name |
(-)-Alpinetin Alpinetin |
| Formula |
C16H14O4 |
| Mw |
270.08920894 |
| CAS RN |
36052-37-6 |
| C_ID |
C00008143
, 
|
| InChIKey |
QQQCWVDPMPFUGF-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C16H14O4/c1-19-14-7-11(17)8-15-16(14)12(18)9-13(20-15)10-5-3-2-4-6-10/h2-8,13,17H,9H2,1H3/t13-/m0/s1 |
| SMILES |
COc1cc(O)cc2c1C(=O)CC(c1ccccc1)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Helichrysum forskahlii  | Ref. |
| Plantae | Asteraceae | Helichrysum spp. | Ref. |
| Plantae | Asteraceae | Mikania micrantha  | Ref. |
| Plantae | Betulaceae | Alnus spp. | Ref. |
| Plantae | Combretaceae | Combretum albopunctatum Suesseng | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Dalbergia parviflora  | Ref. |
| Plantae | Fabaceae | Dalea scandens | Ref. |
| Plantae | Labiatae | Scutellaria amabilis HARA | Ref. |
| Plantae | Labiatae | Scutellaria spp. | Ref. |
| Plantae | Myrtaceae | Eucalyptus spp.  | Ref. |
| Plantae | Piperaceae | Piper spp. | Ref. |
| Plantae | Zingiberaceae | Alpinia mutica  | Ref. |
| Plantae | Zingiberaceae | Alpinia pinnanensis | Ref. |
| Plantae | Zingiberaceae | Alpinia spp.  | Ref. |
| Plantae | Zingiberaceae | Boesenbergia pandurata  | Ref. |
| Plantae | Zingiberaceae | Boesenbergia rotunda (LINN.) MANSF.  | Ref. |
| Plantae | Zingiberaceae | Kaempferia spp. | Ref. |
|
|
zoom in
| Organism | Kaempferia spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 237,Flavanones and dihydroflavonols
Hansel,Planta Med.,15,(1967),443
Kimura,Yakugaku Zasshi,88,(1968),239 |
|---|
|