| Name |
Syringaldehyde 4-Hydroxy-3,5-dimethoxybenzaldehyde |
| Formula |
C9H10O4 |
| Mw |
182.05790881 |
| CAS RN |
134-96-3 |
| C_ID |
C00007558
, 
|
| InChIKey |
KCDXJAYRVLXPFO-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C9H10O4/c1-12-7-3-6(5-10)4-8(13-2)9(7)11/h3-5,11H,1-2H3 |
| SMILES |
COc1cc(C=O)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Rhinacanthus nasutus | Ref. |
| Plantae | Apiaceae | Seseli tortuosum LBS.Eur. | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Asteraceae | Gynura elliptica | Ref. |
| Plantae | Asteraceae | Taraxacum formosanum | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula  | Ref. |
| Plantae | Celastraceae | Gymnosporia trigyna | Ref. |
| Plantae | Celastraceae | Microtropis japonica | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Gesneriaceae | Aeschynanthus bracteatus  | Ref. |
| Plantae | Hydrangeaceae | Hydrangea chinensis | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Lauraceae | Cinnamomum burmannii Nees ex BI  | Ref. |
| Plantae | Lauraceae | Cinnamomum subavenium | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
| Plantae | Malvaceae | Abutilon indicum  | Ref. |
| Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
| Plantae | Moraceae | Brosimum acutifolium  | Ref. |
| Plantae | Myrtaceae | Eugenia sandwicensis | Ref. |
| Plantae | Orchidaceae | Gymnadenia conopsea R.BR. | Ref. |
| Plantae | Piperaceae | Piper solmsianum | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Rubiaceae | Tricalysia dubia | Ref. |
| Plantae | Rutaceae | Boronella koniambiensis | Ref. |
| Plantae | Rutaceae | Vepris uguenensis | Ref. |
| Plantae | Rutaceae | Zanthoxylum ailanthoides | Ref. |
| Plantae | Rutaceae | Zanthoxylum integrifoliolum | Ref. |
| Plantae | Rutaceae | Zanthoxylum wutaiense | Ref. |
| Plantae | Samydaceae | Casearia membranacea | Ref. |
| Plantae | Santalaceae | Viscum coloratum  | Ref. |
| Plantae | Zingiberaceae | Aframomum giganteum | Ref. |
|
|
zoom in
| Organism | Abutilon indicum | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|