| Name |
Apigenin 7-O-beta-D-glucuronide (-)-Apigenin 7-O-beta-D-glucuronide Apigenin 7-glucuronide |
| Formula |
C21H18O11 |
| Mw |
446.08491142 |
| CAS RN |
29741-09-1 |
| C_ID |
C00004144
, 
|
| InChIKey |
JBFOLLJCGUCDQP-GGNWGOABNA-N |
| InChICode |
InChI=1S/C21H18O11/c22-9-3-1-8(2-4-9)13-7-12(24)15-11(23)5-10(6-14(15)31-13)30-21-18(27)16(25)17(26)19(32-21)20(28)29/h1-7,16-19,21-23,25-27H,(H,28,29)/t16-,17-,18+,19+,21+/m0/s1 |
| SMILES |
O=C(O)C1O[C@@H](Oc2cc(O)c3c(=O)cc(-c4ccc(O)cc4)oc3c2)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Acanthus ebracteatus | Ref. |
| Plantae | Acanthaceae | Strobilanthes crispus  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Asteraceae | Bellis perennis  | Ref. |
| Plantae | Asteraceae | Leucanthemum vulgare  | Ref. |
| Plantae | Asteraceae | Santolina chamaecyperissus | Ref. |
| Plantae | Asteraceae | Tanacetum parthenium (L.) Schulz Bip.  | Ref. |
| Plantae | Bignoniaceae | Fernandoa adenophylla | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Labiatae | Glechoma hederacea L.  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Salvia triloba  | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Onagraceae | Fuchsia excorticata  | Ref. |
| Plantae | Onagraceae | Fuchsia procumbens | Ref. |
| Plantae | Plantaginaceae | Picria fel-terrae  | Ref. |
| Plantae | Ranunculaceae | Thalictrum thunbergii | Ref. |
| Plantae | Ricciaceae | Riccia fluitans L | Ref. |
| Plantae | Verbenaceae | Lippia alba  | Ref. |
| - | - | Echinop ritro | Ref. |
|
|
zoom in
| Organism | Thalictrum thunbergii | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Horhammer,Chem.Ber.,102,(1969),1445 |
|---|
|