| Name |
Pyrogallol |
| Formula |
C6H6O3 |
| Mw |
126.03169406 |
| CAS RN |
87-66-1 |
| C_ID |
C00002670
, 
|
| InChIKey |
WQGWDDDVZFFDIG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C6H6O3/c7-4-2-1-3-5(8)6(4)9/h1-3,7-9H |
| SMILES |
Oc1cccc(O)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium sativum  | Ref. |
| Plantae | Asteraceae | Senecio nemorensis | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Fabaceae | Ceratonia siliqua  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Geraniaceae | Geranium thunbergii | Ref. |
| Plantae | Gunneraceae | Gunnera perpensa  | Ref. |
| Plantae | Gunneraceae | Gunnera sp. | Ref. |
| Plantae | Lythraceae | Lagerstroemia speciosa  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus reticulatus  | Ref. |
| Plantae | Piperaceae | Peperomia duclouxii | Ref. |
| Plantae | Plumbaginaceae | Statice gmelinii | Ref. |
| Plantae | Polygonaceae | Rheum maximoviczii | Ref. |
| Plantae | Polygonaceae | Rheum maximowiczii | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Rosaceae | Geum urbanum  | Ref. |
| Plantae | Rosaceae | Rosa spp. | Ref. |
| Plantae | Rosaceae | Rubus rigididus | Ref. |
| Plantae | Rosaceae | Rubus rigidus  | Ref. |
|
|
zoom in
| Organism | Geum urbanum | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Li, et al., JNP, 66, (2003), 1421
Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter40 |
|---|
|