| Name |
Lycopodine (-)-Lycopodine |
| Formula |
C16H25NO |
| Mw |
247.19361443 |
| CAS RN |
466-61-5 |
| C_ID |
C00001948
, 
|
| InChIKey |
BCZFSDNVXODRAJ-NDWPUEIANA-N |
| InChICode |
InChI=1S/C16H25NO/c1-11-8-12-9-15(18)14-5-3-7-17-6-2-4-13(12)16(14,17)10-11/h11-14H,2-10H2,1H3/t11-,12+,13-,14-,16-/m1/s1 |
| SMILES |
C[C@@H]1C[C@H]2CC(=O)[C@H]3CCCN4CCC[C@H]2[C@]34C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lycopodiaceae | Huperzia miyoshiana | Ref. |
| Plantae | Lycopodiaceae | Huperzia selago | Ref. |
| Plantae | Lycopodiaceae | Huperzia serrata  | Ref. |
| Plantae | Lycopodiaceae | Lycopodium alopecuroides | Ref. |
| Plantae | Lycopodiaceae | Lycopodium annotinum | Ref. |
| Plantae | Lycopodiaceae | Lycopodium carolinum | Ref. |
| Plantae | Lycopodiaceae | Lycopodium cernuum  | Ref. |
| Plantae | Lycopodiaceae | Lycopodium clavatum  | Ref. |
| Plantae | Lycopodiaceae | Lycopodium complanatum | Ref. |
| Plantae | Lycopodiaceae | Lycopodium contiguum | Ref. |
| Plantae | Lycopodiaceae | Lycopodium densum | Ref. |
| Plantae | Lycopodiaceae | Lycopodium deuterodensum | Ref. |
| Plantae | Lycopodiaceae | Lycopodium erythraeum | Ref. |
| Plantae | Lycopodiaceae | Lycopodium fastigiatum | Ref. |
| Plantae | Lycopodiaceae | Lycopodium flabelliforme | Ref. |
| Plantae | Lycopodiaceae | Lycopodium inundatum | Ref. |
| Plantae | Lycopodiaceae | Lycopodium issleri | Ref. |
| Plantae | Lycopodiaceae | Lycopodium japonicum | Ref. |
| Plantae | Lycopodiaceae | Lycopodium lucidulum | Ref. |
| Plantae | Lycopodiaceae | Lycopodium lucidum Michx. | Ref. |
| Plantae | Lycopodiaceae | Lycopodium magellanicum | Ref. |
| Plantae | Lycopodiaceae | Lycopodium obscurum | Ref. |
| Plantae | Lycopodiaceae | Lycopodium paniculatum | Ref. |
| Plantae | Lycopodiaceae | Lycopodium phlegmaria | Ref. |
| Plantae | Lycopodiaceae | Lycopodium serratum | Ref. |
| Plantae | Lycopodiaceae | Lycopodium stichense | Ref. |
| Plantae | Lycopodiaceae | Lycopodium thyoides | Ref. |
| Plantae | Lycopodiaceae | Lycopodium tristachyum | Ref. |
| Plantae | Lycopodiaceae | Lycopodium verticillatum | Ref. |
| Plantae | Lycopodiaceae | Lycopodium volubile | Ref. |
| - | - | Palhinhaea cernua | Ref. |
|
|
zoom in
| Organism | Lycopodium japonicum | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Tong, et al., Planta Med, 69, (2003), 576 |
|---|
|